About 2-trimethylsilylethyl 5-oxopentanoate
2-trimethylsilylethyl 5-oxopentanoate (PubChem CID 11127685) has the molecular formula C10H20O3Si
and a molecular weight of 216.35 g/mol. Its IUPAC name is 2-trimethylsilylethyl 5-oxopentanoate.
Molecular Properties
| Compound Name | 2-trimethylsilylethyl 5-oxopentanoate |
| PubChem CID | 11127685 |
| Molecular Formula | C10H20O3Si |
| Molecular Weight | 216.35 g/mol |
| Exact Mass | 216.12 |
| IUPAC Name | 2-trimethylsilylethyl 5-oxopentanoate |
| SMILES | C[Si](C)(C)CCOC(=O)CCCC=O |
| InChI | InChI=1S/C10H20O3Si/c1-14(2,3)9-8-13-10(12)6-4-5-7-11/h7H,4-6,8-9H2,1-3H3 |
| InChIKey | BOJKZUCHNJJJGJ-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.35 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-trimethylsilylethyl 5-oxopentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-trimethylsilylethyl 5-oxopentanoate?
The IUPAC name of 2-trimethylsilylethyl 5-oxopentanoate (CID 11127685) is 2-trimethylsilylethyl 5-oxopentanoate.
What is the SMILES notation for 2-trimethylsilylethyl 5-oxopentanoate?
The canonical SMILES for 2-trimethylsilylethyl 5-oxopentanoate is C[Si](C)(C)CCOC(=O)CCCC=O.
What is the InChIKey of 2-trimethylsilylethyl 5-oxopentanoate?
The InChIKey is BOJKZUCHNJJJGJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20O3Si/c1-14(2,3)9-8-13-10(12)6-4-5-7-11/h7H,4-6,8-9H2,1-3H3.
What are the key properties of 2-trimethylsilylethyl 5-oxopentanoate?
2-trimethylsilylethyl 5-oxopentanoate has a molecular weight of 216.35 g/mol, XLogP of 2.24, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-trimethylsilylethyl 5-oxopentanoate is sourced from PubChem (CID 11127685), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).