About 2-hydroxyethyl 12-oxododec-6-enoate
2-hydroxyethyl 12-oxododec-6-enoate (PubChem CID 57104465) has the molecular formula C14H24O4
and a molecular weight of 256.34 g/mol. Its IUPAC name is 2-hydroxyethyl 12-oxododec-6-enoate.
Molecular Properties
| Compound Name | 2-hydroxyethyl 12-oxododec-6-enoate |
| PubChem CID | 57104465 |
| Molecular Formula | C14H24O4 |
| Molecular Weight | 256.34 g/mol |
| Exact Mass | 256.17 |
| IUPAC Name | 2-hydroxyethyl 12-oxododec-6-enoate |
| SMILES | O=CCCCCC=CCCCCC(=O)OCCO |
| InChI | InChI=1S/C14H24O4/c15-11-9-7-5-3-1-2-4-6-8-10-14(17)18-13-12-16/h1-2,11,16H,3-10,12-13H2 |
| InChIKey | SOOBXCDHWKMPLO-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.34 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxyethyl 12-oxododec-6-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxyethyl 12-oxododec-6-enoate?
The IUPAC name of 2-hydroxyethyl 12-oxododec-6-enoate (CID 57104465) is 2-hydroxyethyl 12-oxododec-6-enoate.
What is the SMILES notation for 2-hydroxyethyl 12-oxododec-6-enoate?
The canonical SMILES for 2-hydroxyethyl 12-oxododec-6-enoate is O=CCCCCC=CCCCCC(=O)OCCO.
What is the InChIKey of 2-hydroxyethyl 12-oxododec-6-enoate?
The InChIKey is SOOBXCDHWKMPLO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24O4/c15-11-9-7-5-3-1-2-4-6-8-10-14(17)18-13-12-16/h1-2,11,16H,3-10,12-13H2.
What are the key properties of 2-hydroxyethyl 12-oxododec-6-enoate?
2-hydroxyethyl 12-oxododec-6-enoate has a molecular weight of 256.34 g/mol, XLogP of 2.40, 12 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxyethyl 12-oxododec-6-enoate is sourced from PubChem (CID 57104465), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).