C20H34O6Si — CID 102409570
1-O-prop-2-enyl 12-O-(2-trimethylsilylethyl) 3,10-dioxododecanedioate (PubChem CID 102409570) has the molecular formula C20H34O6Si and a molecular weight of 398.57 g/mol. Its IUPAC name is 1-O-prop-2-enyl 12-O-(2-trimethylsilylethyl) 3,10-dioxododecanedioate.
| Compound Name | 1-O-prop-2-enyl 12-O-(2-trimethylsilylethyl) 3,10-dioxododecanedioate |
|---|---|
| PubChem CID | 102409570 |
| Molecular Formula | C20H34O6Si |
| Molecular Weight | 398.57 g/mol |
| Exact Mass | 398.21 |
| IUPAC Name | 1-O-prop-2-enyl 12-O-(2-trimethylsilylethyl) 3,10-dioxododecanedioate |
| SMILES | C=CCOC(=O)CC(=O)CCCCCCC(=O)CC(=O)OCC[Si](C)(C)C |
| InChI | InChI=1S/C20H34O6Si/c1-5-12-25-19(23)15-17(21)10-8-6-7-9-11-18(22)16-20(24)26-13-14-27(2,3)4/h5H,1,6-16H2,2-4H3 |
| InChIKey | JUQYKJBVQQCJCB-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.57 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|