About 1-O-[6-[4-(6-acetyloxyhexanoyloxy)butoxy]-6-oxohexyl] 4-O-prop-2-enyl butanedioate
1-O-[6-[4-(6-acetyloxyhexanoyloxy)butoxy]-6-oxohexyl] 4-O-prop-2-enyl butanedioate (PubChem CID 89273836) has the molecular formula C25H40O10
and a molecular weight of 500.59 g/mol. Its IUPAC name is 1-O-[6-[4-(6-acetyloxyhexanoyloxy)butoxy]-6-oxohexyl] 4-O-prop-2-enyl butanedioate.
Molecular Properties
| Compound Name | 1-O-[6-[4-(6-acetyloxyhexanoyloxy)butoxy]-6-oxohexyl] 4-O-prop-2-enyl butanedioate |
| PubChem CID | 89273836 |
| Molecular Formula | C25H40O10 |
| Molecular Weight | 500.59 g/mol |
| Exact Mass | 500.26 |
| IUPAC Name | 1-O-[6-[4-(6-acetyloxyhexanoyloxy)butoxy]-6-oxohexyl] 4-O-prop-2-enyl butanedioate |
| SMILES | C=CCOC(=O)CCC(=O)OCCCCCC(=O)OCCCCOC(=O)CCCCCOC(C)=O |
| InChI | InChI=1S/C25H40O10/c1-3-16-32-24(29)14-15-25(30)35-18-9-5-7-13-23(28)34-20-11-10-19-33-22(27)12-6-4-8-17-31-21(2)26/h3H,1,4-20H2,2H3 |
| InChIKey | VQBVUHKILPEWHL-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 131.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 500.59 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-O-[6-[4-(6-acetyloxyhexanoyloxy)butoxy]-6-oxohexyl] 4-O-prop-2-enyl butanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-[6-[4-(6-acetyloxyhexanoyloxy)butoxy]-6-oxohexyl] 4-O-prop-2-enyl butanedioate?
The IUPAC name of 1-O-[6-[4-(6-acetyloxyhexanoyloxy)butoxy]-6-oxohexyl] 4-O-prop-2-enyl butanedioate (CID 89273836) is 1-O-[6-[4-(6-acetyloxyhexanoyloxy)butoxy]-6-oxohexyl] 4-O-prop-2-enyl butanedioate.
What is the SMILES notation for 1-O-[6-[4-(6-acetyloxyhexanoyloxy)butoxy]-6-oxohexyl] 4-O-prop-2-enyl butanedioate?
The canonical SMILES for 1-O-[6-[4-(6-acetyloxyhexanoyloxy)butoxy]-6-oxohexyl] 4-O-prop-2-enyl butanedioate is C=CCOC(=O)CCC(=O)OCCCCCC(=O)OCCCCOC(=O)CCCCCOC(C)=O.
What is the InChIKey of 1-O-[6-[4-(6-acetyloxyhexanoyloxy)butoxy]-6-oxohexyl] 4-O-prop-2-enyl butanedioate?
The InChIKey is VQBVUHKILPEWHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H40O10/c1-3-16-32-24(29)14-15-25(30)35-18-9-5-7-13-23(28)34-20-11-10-19-33-22(27)12-6-4-8-17-31-21(2)26/h3H,1,4-20H2,2H3.
What are the key properties of 1-O-[6-[4-(6-acetyloxyhexanoyloxy)butoxy]-6-oxohexyl] 4-O-prop-2-enyl butanedioate?
1-O-[6-[4-(6-acetyloxyhexanoyloxy)butoxy]-6-oxohexyl] 4-O-prop-2-enyl butanedioate has a molecular weight of 500.59 g/mol, XLogP of 3.59, 22 rotatable bonds, 0 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-[6-[4-(6-acetyloxyhexanoyloxy)butoxy]-6-oxohexyl] 4-O-prop-2-enyl butanedioate is sourced from PubChem (CID 89273836), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).