About 4-hydroxybutyl acetate;prop-2-enyl acetate
4-hydroxybutyl acetate;prop-2-enyl acetate (PubChem CID 88766466) has the molecular formula C11H20O5
and a molecular weight of 232.28 g/mol. Its IUPAC name is 4-hydroxybutyl acetate;prop-2-enyl acetate.
Molecular Properties
| Compound Name | 4-hydroxybutyl acetate;prop-2-enyl acetate |
| PubChem CID | 88766466 |
| Molecular Formula | C11H20O5 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.13 |
| IUPAC Name | 4-hydroxybutyl acetate;prop-2-enyl acetate |
| SMILES | C=CCOC(C)=O.CC(=O)OCCCCO |
| InChI | InChI=1S/C6H12O3.C5H8O2/c1-6(8)9-5-3-2-4-7;1-3-4-7-5(2)6/h7H,2-5H2,1H3;3H,1,4H2,2H3 |
| InChIKey | RIKRIZJMRDZHQB-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-hydroxybutyl acetate;prop-2-enyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hydroxybutyl acetate;prop-2-enyl acetate?
The IUPAC name of 4-hydroxybutyl acetate;prop-2-enyl acetate (CID 88766466) is 4-hydroxybutyl acetate;prop-2-enyl acetate.
What is the SMILES notation for 4-hydroxybutyl acetate;prop-2-enyl acetate?
The canonical SMILES for 4-hydroxybutyl acetate;prop-2-enyl acetate is C=CCOC(C)=O.CC(=O)OCCCCO.
What is the InChIKey of 4-hydroxybutyl acetate;prop-2-enyl acetate?
The InChIKey is RIKRIZJMRDZHQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12O3.C5H8O2/c1-6(8)9-5-3-2-4-7;1-3-4-7-5(2)6/h7H,2-5H2,1H3;3H,1,4H2,2H3.
What are the key properties of 4-hydroxybutyl acetate;prop-2-enyl acetate?
4-hydroxybutyl acetate;prop-2-enyl acetate has a molecular weight of 232.28 g/mol, XLogP of 1.06, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hydroxybutyl acetate;prop-2-enyl acetate is sourced from PubChem (CID 88766466), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).