C13H27NO4Si — CID 156767749
(2S)-2-[deuteriomethyl(2-trimethylsilylethoxycarbonyl)amino]-4-methylpentanoic acid (PubChem CID 156767749) has the molecular formula C13H27NO4Si and a molecular weight of 290.45 g/mol. Its IUPAC name is (2S)-2-[deuteriomethyl(2-trimethylsilylethoxycarbonyl)amino]-4-methylpentanoic acid.
| Compound Name | (2S)-2-[deuteriomethyl(2-trimethylsilylethoxycarbonyl)amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 156767749 |
| Molecular Formula | C13H27NO4Si |
| Molecular Weight | 290.45 g/mol |
| Exact Mass | 290.18 |
| IUPAC Name | (2S)-2-[deuteriomethyl(2-trimethylsilylethoxycarbonyl)amino]-4-methylpentanoic acid |
| SMILES | [2H]CN(C(=O)OCC[Si](C)(C)C)[C@@H](CC(C)C)C(=O)O |
| InChI | InChI=1S/C13H27NO4Si/c1-10(2)9-11(12(15)16)14(3)13(17)18-7-8-19(4,5)6/h10-11H,7-9H2,1-6H3,(H,15,16)/t11-/m0/s1/i3D |
| InChIKey | ISZJODSUCSTOSW-HVCJDPPDSA-N |
| XLogP | 2.89 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.45 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|