C6H11Br2NO2 — CID 57045725
(2S)-2-(dibromoamino)-4-methylpentanoic acid (PubChem CID 57045725) has the molecular formula C6H11Br2NO2 and a molecular weight of 288.97 g/mol. Its IUPAC name is (2S)-2-(dibromoamino)-4-methylpentanoic acid.
| Compound Name | (2S)-2-(dibromoamino)-4-methylpentanoic acid |
|---|---|
| PubChem CID | 57045725 |
| Molecular Formula | C6H11Br2NO2 |
| Molecular Weight | 288.97 g/mol |
| Exact Mass | 286.92 |
| IUPAC Name | (2S)-2-(dibromoamino)-4-methylpentanoic acid |
| SMILES | CC(C)C[C@@H](C(=O)O)N(Br)Br |
| InChI | InChI=1S/C6H11Br2NO2/c1-4(2)3-5(6(10)11)9(7)8/h4-5H,3H2,1-2H3,(H,10,11)/t5-/m0/s1 |
| InChIKey | HJFWUSUVAUZCQI-YFKPBYRVSA-N |
| XLogP | 2.41 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.97 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|