C8H19N3O6S2 — CID 141451916
(2R)-2-[bis(methylsulfamoyl)amino]-4-methylpentanoic acid (PubChem CID 141451916) has the molecular formula C8H19N3O6S2 and a molecular weight of 317.39 g/mol. Its IUPAC name is (2R)-2-[bis(methylsulfamoyl)amino]-4-methylpentanoic acid.
| Compound Name | (2R)-2-[bis(methylsulfamoyl)amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 141451916 |
| Molecular Formula | C8H19N3O6S2 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.07 |
| IUPAC Name | (2R)-2-[bis(methylsulfamoyl)amino]-4-methylpentanoic acid |
| SMILES | CNS(=O)(=O)N([C@H](CC(C)C)C(=O)O)S(=O)(=O)NC |
| InChI | InChI=1S/C8H19N3O6S2/c1-6(2)5-7(8(12)13)11(18(14,15)9-3)19(16,17)10-4/h6-7,9-10H,5H2,1-4H3,(H,12,13)/t7-/m1/s1 |
| InChIKey | FWZIVACWSRQMRN-SSDOTTSWSA-N |
| XLogP | -1.28 |
| TPSA | 132.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | -1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |