C12H27NO3Si — CID 175137826
(2S)-4-methyl-2-[methyl(2-trimethylsilyloxyethyl)amino]pentanoic acid (PubChem CID 175137826) has the molecular formula C12H27NO3Si and a molecular weight of 261.44 g/mol. Its IUPAC name is (2S)-4-methyl-2-[methyl(2-trimethylsilyloxyethyl)amino]pentanoic acid.
| Compound Name | (2S)-4-methyl-2-[methyl(2-trimethylsilyloxyethyl)amino]pentanoic acid |
|---|---|
| PubChem CID | 175137826 |
| Molecular Formula | C12H27NO3Si |
| Molecular Weight | 261.44 g/mol |
| Exact Mass | 261.18 |
| IUPAC Name | (2S)-4-methyl-2-[methyl(2-trimethylsilyloxyethyl)amino]pentanoic acid |
| SMILES | CC(C)C[C@@H](C(=O)O)N(C)CCO[Si](C)(C)C |
| InChI | InChI=1S/C12H27NO3Si/c1-10(2)9-11(12(14)15)13(3)7-8-16-17(4,5)6/h10-11H,7-9H2,1-6H3,(H,14,15)/t11-/m0/s1 |
| InChIKey | AKSWSLNJRNABIB-NSHDSACASA-N |
| XLogP | 2.27 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.44 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|