C12H25NO8 — CID 87925416
(2S)-2-[bis(2,3-dihydroxypropoxy)amino]-4-methylpentanoic acid (PubChem CID 87925416) has the molecular formula C12H25NO8 and a molecular weight of 311.33 g/mol. Its IUPAC name is (2S)-2-[bis(2,3-dihydroxypropoxy)amino]-4-methylpentanoic acid.
| Compound Name | (2S)-2-[bis(2,3-dihydroxypropoxy)amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 87925416 |
| Molecular Formula | C12H25NO8 |
| Molecular Weight | 311.33 g/mol |
| Exact Mass | 311.16 |
| IUPAC Name | (2S)-2-[bis(2,3-dihydroxypropoxy)amino]-4-methylpentanoic acid |
| SMILES | CC(C)C[C@@H](C(=O)O)N(OCC(O)CO)OCC(O)CO |
| InChI | InChI=1S/C12H25NO8/c1-8(2)3-11(12(18)19)13(20-6-9(16)4-14)21-7-10(17)5-15/h8-11,14-17H,3-7H2,1-2H3,(H,18,19)/t9?,10?,11-/m0/s1 |
| InChIKey | VIRHPTXWIGLESN-ILDUYXDCSA-N |
| XLogP | -1.64 |
| TPSA | 139.92 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.33 |
| LogP ≤ 5 | -1.64 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|