C15H22F2N2O — CID 60688234
N-(2,6-difluorophenyl)-2-(heptan-2-ylamino)acetamide (PubChem CID 60688234) has the molecular formula C15H22F2N2O and a molecular weight of 284.35 g/mol. Its IUPAC name is N-(2,6-difluorophenyl)-2-(heptan-2-ylamino)acetamide.
| Compound Name | N-(2,6-difluorophenyl)-2-(heptan-2-ylamino)acetamide |
|---|---|
| PubChem CID | 60688234 |
| Molecular Formula | C15H22F2N2O |
| Molecular Weight | 284.35 g/mol |
| Exact Mass | 284.17 |
| IUPAC Name | N-(2,6-difluorophenyl)-2-(heptan-2-ylamino)acetamide |
| SMILES | CCCCCC(C)NCC(=O)Nc1c(F)cccc1F |
| InChI | InChI=1S/C15H22F2N2O/c1-3-4-5-7-11(2)18-10-14(20)19-15-12(16)8-6-9-13(15)17/h6,8-9,11,18H,3-5,7,10H2,1-2H3,(H,19,20) |
| InChIKey | FBPPXZDYTYJMAD-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.35 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|