C15H22F2N2S — CID 81285443
3,5-difluoro-4-(octan-2-ylamino)benzenecarbothioamide (PubChem CID 81285443) has the molecular formula C15H22F2N2S and a molecular weight of 300.42 g/mol. Its IUPAC name is 3,5-difluoro-4-(octan-2-ylamino)benzenecarbothioamide.
| Compound Name | 3,5-difluoro-4-(octan-2-ylamino)benzenecarbothioamide |
|---|---|
| PubChem CID | 81285443 |
| Molecular Formula | C15H22F2N2S |
| Molecular Weight | 300.42 g/mol |
| Exact Mass | 300.15 |
| IUPAC Name | 3,5-difluoro-4-(octan-2-ylamino)benzenecarbothioamide |
| SMILES | CCCCCCC(C)Nc1c(F)cc(C(N)=S)cc1F |
| InChI | InChI=1S/C15H22F2N2S/c1-3-4-5-6-7-10(2)19-14-12(16)8-11(15(18)20)9-13(14)17/h8-10,19H,3-7H2,1-2H3,(H2,18,20) |
| InChIKey | WFFYHQRIQRNFOK-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.42 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|