C13H14F2N4S — CID 81286265
3,5-difluoro-4-(1-imidazol-1-ylpropan-2-ylamino)benzenecarbothioamide (PubChem CID 81286265) has the molecular formula C13H14F2N4S and a molecular weight of 296.35 g/mol. Its IUPAC name is 3,5-difluoro-4-(1-imidazol-1-ylpropan-2-ylamino)benzenecarbothioamide.
| Compound Name | 3,5-difluoro-4-(1-imidazol-1-ylpropan-2-ylamino)benzenecarbothioamide |
|---|---|
| PubChem CID | 81286265 |
| Molecular Formula | C13H14F2N4S |
| Molecular Weight | 296.35 g/mol |
| Exact Mass | 296.09 |
| IUPAC Name | 3,5-difluoro-4-(1-imidazol-1-ylpropan-2-ylamino)benzenecarbothioamide |
| SMILES | CC(Cn1ccnc1)Nc1c(F)cc(C(N)=S)cc1F |
| InChI | InChI=1S/C13H14F2N4S/c1-8(6-19-3-2-17-7-19)18-12-10(14)4-9(13(16)20)5-11(12)15/h2-5,7-8,18H,6H2,1H3,(H2,16,20) |
| InChIKey | DJCLNYCSUFCIQN-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.35 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|