C11H12ClFN4 — CID 79727326
5-chloro-3-fluoro-N-(1-imidazol-1-ylpropan-2-yl)pyridin-2-amine (PubChem CID 79727326) has the molecular formula C11H12ClFN4 and a molecular weight of 254.70 g/mol. Its IUPAC name is 5-chloro-3-fluoro-N-(1-imidazol-1-ylpropan-2-yl)pyridin-2-amine.
| Compound Name | 5-chloro-3-fluoro-N-(1-imidazol-1-ylpropan-2-yl)pyridin-2-amine |
|---|---|
| PubChem CID | 79727326 |
| Molecular Formula | C11H12ClFN4 |
| Molecular Weight | 254.70 g/mol |
| Exact Mass | 254.07 |
| IUPAC Name | 5-chloro-3-fluoro-N-(1-imidazol-1-ylpropan-2-yl)pyridin-2-amine |
| SMILES | CC(Cn1ccnc1)Nc1ncc(Cl)cc1F |
| InChI | InChI=1S/C11H12ClFN4/c1-8(6-17-3-2-14-7-17)16-11-10(13)4-9(12)5-15-11/h2-5,7-8H,6H2,1H3,(H,15,16) |
| InChIKey | VBMSOLDSIOZZRO-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.70 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |