C13H13F2N3O2 — CID 63185406
3,5-difluoro-4-(1-imidazol-1-ylpropan-2-ylamino)benzoic acid (PubChem CID 63185406) has the molecular formula C13H13F2N3O2 and a molecular weight of 281.26 g/mol. Its IUPAC name is 3,5-difluoro-4-(1-imidazol-1-ylpropan-2-ylamino)benzoic acid.
| Compound Name | 3,5-difluoro-4-(1-imidazol-1-ylpropan-2-ylamino)benzoic acid |
|---|---|
| PubChem CID | 63185406 |
| Molecular Formula | C13H13F2N3O2 |
| Molecular Weight | 281.26 g/mol |
| Exact Mass | 281.10 |
| IUPAC Name | 3,5-difluoro-4-(1-imidazol-1-ylpropan-2-ylamino)benzoic acid |
| SMILES | CC(Cn1ccnc1)Nc1c(F)cc(C(=O)O)cc1F |
| InChI | InChI=1S/C13H13F2N3O2/c1-8(6-18-3-2-16-7-18)17-12-10(14)4-9(13(19)20)5-11(12)15/h2-5,7-8,17H,6H2,1H3,(H,19,20) |
| InChIKey | IUNJLLCDEVRZNO-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.26 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |