C13H15ClN4S — CID 63092980
4-chloro-2-(1-imidazol-1-ylpropan-2-ylamino)benzenecarbothioamide (PubChem CID 63092980) has the molecular formula C13H15ClN4S and a molecular weight of 294.81 g/mol. Its IUPAC name is 4-chloro-2-(1-imidazol-1-ylpropan-2-ylamino)benzenecarbothioamide.
| Compound Name | 4-chloro-2-(1-imidazol-1-ylpropan-2-ylamino)benzenecarbothioamide |
|---|---|
| PubChem CID | 63092980 |
| Molecular Formula | C13H15ClN4S |
| Molecular Weight | 294.81 g/mol |
| Exact Mass | 294.07 |
| IUPAC Name | 4-chloro-2-(1-imidazol-1-ylpropan-2-ylamino)benzenecarbothioamide |
| SMILES | CC(Cn1ccnc1)Nc1cc(Cl)ccc1C(N)=S |
| InChI | InChI=1S/C13H15ClN4S/c1-9(7-18-5-4-16-8-18)17-12-6-10(14)2-3-11(12)13(15)19/h2-6,8-9,17H,7H2,1H3,(H2,15,19) |
| InChIKey | NRUNUHJJKZQVKL-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.81 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|