C13H16F4N2O — CID 107644485
N-(2-methylpropyl)-2-(2,3,5,6-tetrafluoroanilino)propanamide (PubChem CID 107644485) has the molecular formula C13H16F4N2O and a molecular weight of 292.28 g/mol. Its IUPAC name is N-(2-methylpropyl)-2-(2,3,5,6-tetrafluoroanilino)propanamide.
| Compound Name | N-(2-methylpropyl)-2-(2,3,5,6-tetrafluoroanilino)propanamide |
|---|---|
| PubChem CID | 107644485 |
| Molecular Formula | C13H16F4N2O |
| Molecular Weight | 292.28 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | N-(2-methylpropyl)-2-(2,3,5,6-tetrafluoroanilino)propanamide |
| SMILES | CC(C)CNC(=O)C(C)Nc1c(F)c(F)cc(F)c1F |
| InChI | InChI=1S/C13H16F4N2O/c1-6(2)5-18-13(20)7(3)19-12-10(16)8(14)4-9(15)11(12)17/h4,6-7,19H,5H2,1-3H3,(H,18,20) |
| InChIKey | RRFJJPZOHYYBEA-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.28 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|