C13H17F3N2O — CID 55118207
N-(2-methylpropyl)-2-(2,4,5-trifluoroanilino)propanamide (PubChem CID 55118207) has the molecular formula C13H17F3N2O and a molecular weight of 274.29 g/mol. Its IUPAC name is N-(2-methylpropyl)-2-(2,4,5-trifluoroanilino)propanamide.
| Compound Name | N-(2-methylpropyl)-2-(2,4,5-trifluoroanilino)propanamide |
|---|---|
| PubChem CID | 55118207 |
| Molecular Formula | C13H17F3N2O |
| Molecular Weight | 274.29 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | N-(2-methylpropyl)-2-(2,4,5-trifluoroanilino)propanamide |
| SMILES | CC(C)CNC(=O)C(C)Nc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C13H17F3N2O/c1-7(2)6-17-13(19)8(3)18-12-5-10(15)9(14)4-11(12)16/h4-5,7-8,18H,6H2,1-3H3,(H,17,19) |
| InChIKey | RGQLPTAEIFQMGY-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.29 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|