C10H10F3N3O2 — CID 55118208
N-carbamoyl-2-(2,4,5-trifluoroanilino)propanamide (PubChem CID 55118208) has the molecular formula C10H10F3N3O2 and a molecular weight of 261.20 g/mol. Its IUPAC name is N-carbamoyl-2-(2,4,5-trifluoroanilino)propanamide.
| Compound Name | N-carbamoyl-2-(2,4,5-trifluoroanilino)propanamide |
|---|---|
| PubChem CID | 55118208 |
| Molecular Formula | C10H10F3N3O2 |
| Molecular Weight | 261.20 g/mol |
| Exact Mass | 261.07 |
| IUPAC Name | N-carbamoyl-2-(2,4,5-trifluoroanilino)propanamide |
| SMILES | CC(Nc1cc(F)c(F)cc1F)C(=O)NC(N)=O |
| InChI | InChI=1S/C10H10F3N3O2/c1-4(9(17)16-10(14)18)15-8-3-6(12)5(11)2-7(8)13/h2-4,15H,1H3,(H3,14,16,17,18) |
| InChIKey | MPEOIMCYXFVJPD-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.20 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|