C14H18F4N2O — CID 107644351
N-(3-methylbutyl)-2-(2,3,5,6-tetrafluoroanilino)propanamide (PubChem CID 107644351) has the molecular formula C14H18F4N2O and a molecular weight of 306.30 g/mol. Its IUPAC name is N-(3-methylbutyl)-2-(2,3,5,6-tetrafluoroanilino)propanamide.
| Compound Name | N-(3-methylbutyl)-2-(2,3,5,6-tetrafluoroanilino)propanamide |
|---|---|
| PubChem CID | 107644351 |
| Molecular Formula | C14H18F4N2O |
| Molecular Weight | 306.30 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | N-(3-methylbutyl)-2-(2,3,5,6-tetrafluoroanilino)propanamide |
| SMILES | CC(C)CCNC(=O)C(C)Nc1c(F)c(F)cc(F)c1F |
| InChI | InChI=1S/C14H18F4N2O/c1-7(2)4-5-19-14(21)8(3)20-13-11(17)9(15)6-10(16)12(13)18/h6-8,20H,4-5H2,1-3H3,(H,19,21) |
| InChIKey | SMGPZQHZUZFUOB-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.30 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|