C10H15FN2 — CID 79677016
3-N-butan-2-yl-4-fluorobenzene-1,3-diamine (PubChem CID 79677016) has the molecular formula C10H15FN2 and a molecular weight of 182.24 g/mol. Its IUPAC name is 3-N-butan-2-yl-4-fluorobenzene-1,3-diamine.
| Compound Name | 3-N-butan-2-yl-4-fluorobenzene-1,3-diamine |
|---|---|
| PubChem CID | 79677016 |
| Molecular Formula | C10H15FN2 |
| Molecular Weight | 182.24 g/mol |
| Exact Mass | 182.12 |
| IUPAC Name | 3-N-butan-2-yl-4-fluorobenzene-1,3-diamine |
| SMILES | CCC(C)Nc1cc(N)ccc1F |
| InChI | InChI=1S/C10H15FN2/c1-3-7(2)13-10-6-8(12)4-5-9(10)11/h4-7,13H,3,12H2,1-2H3 |
| InChIKey | GVDOWYRUDYXOSZ-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.24 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|