C13H20FN3 — CID 54952869
2-fluoro-1-N-(1-pyrrolidin-1-ylpropan-2-yl)benzene-1,4-diamine (PubChem CID 54952869) has the molecular formula C13H20FN3 and a molecular weight of 237.32 g/mol. Its IUPAC name is 2-fluoro-1-N-(1-pyrrolidin-1-ylpropan-2-yl)benzene-1,4-diamine.
| Compound Name | 2-fluoro-1-N-(1-pyrrolidin-1-ylpropan-2-yl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 54952869 |
| Molecular Formula | C13H20FN3 |
| Molecular Weight | 237.32 g/mol |
| Exact Mass | 237.16 |
| IUPAC Name | 2-fluoro-1-N-(1-pyrrolidin-1-ylpropan-2-yl)benzene-1,4-diamine |
| SMILES | CC(CN1CCCC1)Nc1ccc(N)cc1F |
| InChI | InChI=1S/C13H20FN3/c1-10(9-17-6-2-3-7-17)16-13-5-4-11(15)8-12(13)14/h4-5,8,10,16H,2-3,6-7,9,15H2,1H3 |
| InChIKey | GKQCRERHQYMYJP-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.32 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|