C17H24N4 — CID 103000719
4-N-(1-piperidin-1-ylpropan-2-yl)quinoline-4,7-diamine (PubChem CID 103000719) has the molecular formula C17H24N4 and a molecular weight of 284.41 g/mol. Its IUPAC name is 4-N-(1-piperidin-1-ylpropan-2-yl)quinoline-4,7-diamine.
| Compound Name | 4-N-(1-piperidin-1-ylpropan-2-yl)quinoline-4,7-diamine |
|---|---|
| PubChem CID | 103000719 |
| Molecular Formula | C17H24N4 |
| Molecular Weight | 284.41 g/mol |
| Exact Mass | 284.20 |
| IUPAC Name | 4-N-(1-piperidin-1-ylpropan-2-yl)quinoline-4,7-diamine |
| SMILES | CC(CN1CCCCC1)Nc1ccnc2cc(N)ccc12 |
| InChI | InChI=1S/C17H24N4/c1-13(12-21-9-3-2-4-10-21)20-16-7-8-19-17-11-14(18)5-6-15(16)17/h5-8,11,13H,2-4,9-10,12,18H2,1H3,(H,19,20) |
| InChIKey | JBBBCRNQFUHIQE-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.41 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|