C15H21N5 — CID 64588497
4-N-(1-pyrrolidin-1-ylpropan-2-yl)quinazoline-4,6-diamine (PubChem CID 64588497) has the molecular formula C15H21N5 and a molecular weight of 271.37 g/mol. Its IUPAC name is 4-N-(1-pyrrolidin-1-ylpropan-2-yl)quinazoline-4,6-diamine.
| Compound Name | 4-N-(1-pyrrolidin-1-ylpropan-2-yl)quinazoline-4,6-diamine |
|---|---|
| PubChem CID | 64588497 |
| Molecular Formula | C15H21N5 |
| Molecular Weight | 271.37 g/mol |
| Exact Mass | 271.18 |
| IUPAC Name | 4-N-(1-pyrrolidin-1-ylpropan-2-yl)quinazoline-4,6-diamine |
| SMILES | CC(CN1CCCC1)Nc1ncnc2ccc(N)cc12 |
| InChI | InChI=1S/C15H21N5/c1-11(9-20-6-2-3-7-20)19-15-13-8-12(16)4-5-14(13)17-10-18-15/h4-5,8,10-11H,2-3,6-7,9,16H2,1H3,(H,17,18,19) |
| InChIKey | JRLPSOYWARGRND-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.37 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|