C14H16N6 — CID 65337116
4-N-(1-imidazol-1-ylpropan-2-yl)quinazoline-4,7-diamine (PubChem CID 65337116) has the molecular formula C14H16N6 and a molecular weight of 268.32 g/mol. Its IUPAC name is 4-N-(1-imidazol-1-ylpropan-2-yl)quinazoline-4,7-diamine.
| Compound Name | 4-N-(1-imidazol-1-ylpropan-2-yl)quinazoline-4,7-diamine |
|---|---|
| PubChem CID | 65337116 |
| Molecular Formula | C14H16N6 |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.14 |
| IUPAC Name | 4-N-(1-imidazol-1-ylpropan-2-yl)quinazoline-4,7-diamine |
| SMILES | CC(Cn1ccnc1)Nc1ncnc2cc(N)ccc12 |
| InChI | InChI=1S/C14H16N6/c1-10(7-20-5-4-16-9-20)19-14-12-3-2-11(15)6-13(12)17-8-18-14/h2-6,8-10H,7,15H2,1H3,(H,17,18,19) |
| InChIKey | JKWYTPOXFFLBFP-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 81.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|