C14H23N3 — CID 62590164
4-methyl-3-N-(1-pyrrolidin-1-ylpropan-2-yl)benzene-1,3-diamine (PubChem CID 62590164) has the molecular formula C14H23N3 and a molecular weight of 233.36 g/mol. Its IUPAC name is 4-methyl-3-N-(1-pyrrolidin-1-ylpropan-2-yl)benzene-1,3-diamine.
| Compound Name | 4-methyl-3-N-(1-pyrrolidin-1-ylpropan-2-yl)benzene-1,3-diamine |
|---|---|
| PubChem CID | 62590164 |
| Molecular Formula | C14H23N3 |
| Molecular Weight | 233.36 g/mol |
| Exact Mass | 233.19 |
| IUPAC Name | 4-methyl-3-N-(1-pyrrolidin-1-ylpropan-2-yl)benzene-1,3-diamine |
| SMILES | Cc1ccc(N)cc1NC(C)CN1CCCC1 |
| InChI | InChI=1S/C14H23N3/c1-11-5-6-13(15)9-14(11)16-12(2)10-17-7-3-4-8-17/h5-6,9,12,16H,3-4,7-8,10,15H2,1-2H3 |
| InChIKey | MBCXXRUYQGPHSP-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.36 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|