C14H14N4S — CID 103001288
4-N-[1-(1,3-thiazol-2-yl)ethyl]quinoline-4,7-diamine (PubChem CID 103001288) has the molecular formula C14H14N4S and a molecular weight of 270.36 g/mol. Its IUPAC name is 4-N-[1-(1,3-thiazol-2-yl)ethyl]quinoline-4,7-diamine.
| Compound Name | 4-N-[1-(1,3-thiazol-2-yl)ethyl]quinoline-4,7-diamine |
|---|---|
| PubChem CID | 103001288 |
| Molecular Formula | C14H14N4S |
| Molecular Weight | 270.36 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | 4-N-[1-(1,3-thiazol-2-yl)ethyl]quinoline-4,7-diamine |
| SMILES | CC(Nc1ccnc2cc(N)ccc12)c1nccs1 |
| InChI | InChI=1S/C14H14N4S/c1-9(14-17-6-7-19-14)18-12-4-5-16-13-8-10(15)2-3-11(12)13/h2-9H,15H2,1H3,(H,16,18) |
| InChIKey | RFVPACHZQYUWGO-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.36 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|