C16H18N4S — CID 103000741
4-N-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]quinoline-4,7-diamine (PubChem CID 103000741) has the molecular formula C16H18N4S and a molecular weight of 298.42 g/mol. Its IUPAC name is 4-N-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]quinoline-4,7-diamine.
| Compound Name | 4-N-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]quinoline-4,7-diamine |
|---|---|
| PubChem CID | 103000741 |
| Molecular Formula | C16H18N4S |
| Molecular Weight | 298.42 g/mol |
| Exact Mass | 298.13 |
| IUPAC Name | 4-N-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]quinoline-4,7-diamine |
| SMILES | Cc1nc(C)c(C(C)Nc2ccnc3cc(N)ccc23)s1 |
| InChI | InChI=1S/C16H18N4S/c1-9-16(21-11(3)19-9)10(2)20-14-6-7-18-15-8-12(17)4-5-13(14)15/h4-8,10H,17H2,1-3H3,(H,18,20) |
| InChIKey | HINGNDACPIQRLM-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.42 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|