C16H17N3S — CID 63753119
N-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]quinolin-6-amine (PubChem CID 63753119) has the molecular formula C16H17N3S and a molecular weight of 283.40 g/mol. Its IUPAC name is N-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]quinolin-6-amine.
| Compound Name | N-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]quinolin-6-amine |
|---|---|
| PubChem CID | 63753119 |
| Molecular Formula | C16H17N3S |
| Molecular Weight | 283.40 g/mol |
| Exact Mass | 283.11 |
| IUPAC Name | N-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]quinolin-6-amine |
| SMILES | Cc1nc(C)c(C(C)Nc2ccc3ncccc3c2)s1 |
| InChI | InChI=1S/C16H17N3S/c1-10-16(20-12(3)18-10)11(2)19-14-6-7-15-13(9-14)5-4-8-17-15/h4-9,11,19H,1-3H3 |
| InChIKey | YXHHGMRQQGSANB-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.40 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |