C16H21N3OS — CID 63751777
3-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethylamino]-N-ethylbenzamide (PubChem CID 63751777) has the molecular formula C16H21N3OS and a molecular weight of 303.43 g/mol. Its IUPAC name is 3-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethylamino]-N-ethylbenzamide.
| Compound Name | 3-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethylamino]-N-ethylbenzamide |
|---|---|
| PubChem CID | 63751777 |
| Molecular Formula | C16H21N3OS |
| Molecular Weight | 303.43 g/mol |
| Exact Mass | 303.14 |
| IUPAC Name | 3-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethylamino]-N-ethylbenzamide |
| SMILES | CCNC(=O)c1cccc(NC(C)c2sc(C)nc2C)c1 |
| InChI | InChI=1S/C16H21N3OS/c1-5-17-16(20)13-7-6-8-14(9-13)19-11(3)15-10(2)18-12(4)21-15/h6-9,11,19H,5H2,1-4H3,(H,17,20) |
| InChIKey | RPWRZENMUANLOU-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.43 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |