C14H13N3S — CID 115928696
N-[1-(1,3-thiazol-4-yl)ethyl]quinolin-6-amine (PubChem CID 115928696) has the molecular formula C14H13N3S and a molecular weight of 255.35 g/mol. Its IUPAC name is N-[1-(1,3-thiazol-4-yl)ethyl]quinolin-6-amine.
| Compound Name | N-[1-(1,3-thiazol-4-yl)ethyl]quinolin-6-amine |
|---|---|
| PubChem CID | 115928696 |
| Molecular Formula | C14H13N3S |
| Molecular Weight | 255.35 g/mol |
| Exact Mass | 255.08 |
| IUPAC Name | N-[1-(1,3-thiazol-4-yl)ethyl]quinolin-6-amine |
| SMILES | CC(Nc1ccc2ncccc2c1)c1cscn1 |
| InChI | InChI=1S/C14H13N3S/c1-10(14-8-18-9-16-14)17-12-4-5-13-11(7-12)3-2-6-15-13/h2-10,17H,1H3 |
| InChIKey | NUSGBNQNXRBLDR-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.35 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |