C11H10ClIN2S — CID 64993233
2-chloro-4-iodo-N-[1-(1,3-thiazol-2-yl)ethyl]aniline (PubChem CID 64993233) has the molecular formula C11H10ClIN2S and a molecular weight of 364.64 g/mol. Its IUPAC name is 2-chloro-4-iodo-N-[1-(1,3-thiazol-2-yl)ethyl]aniline.
| Compound Name | 2-chloro-4-iodo-N-[1-(1,3-thiazol-2-yl)ethyl]aniline |
|---|---|
| PubChem CID | 64993233 |
| Molecular Formula | C11H10ClIN2S |
| Molecular Weight | 364.64 g/mol |
| Exact Mass | 363.93 |
| IUPAC Name | 2-chloro-4-iodo-N-[1-(1,3-thiazol-2-yl)ethyl]aniline |
| SMILES | CC(Nc1ccc(I)cc1Cl)c1nccs1 |
| InChI | InChI=1S/C11H10ClIN2S/c1-7(11-14-4-5-16-11)15-10-3-2-8(13)6-9(10)12/h2-7,15H,1H3 |
| InChIKey | ACBROJKQHZGSHS-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.64 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|