C10H10ClN3S — CID 97357874
2-chloro-N-[(1R)-1-(1,3-thiazol-2-yl)ethyl]pyridin-4-amine (PubChem CID 97357874) has the molecular formula C10H10ClN3S and a molecular weight of 239.73 g/mol. Its IUPAC name is 2-chloro-N-[(1R)-1-(1,3-thiazol-2-yl)ethyl]pyridin-4-amine.
| Compound Name | 2-chloro-N-[(1R)-1-(1,3-thiazol-2-yl)ethyl]pyridin-4-amine |
|---|---|
| PubChem CID | 97357874 |
| Molecular Formula | C10H10ClN3S |
| Molecular Weight | 239.73 g/mol |
| Exact Mass | 239.03 |
| IUPAC Name | 2-chloro-N-[(1R)-1-(1,3-thiazol-2-yl)ethyl]pyridin-4-amine |
| SMILES | C[C@@H](Nc1ccnc(Cl)c1)c1nccs1 |
| InChI | InChI=1S/C10H10ClN3S/c1-7(10-13-4-5-15-10)14-8-2-3-12-9(11)6-8/h2-7H,1H3,(H,12,14)/t7-/m1/s1 |
| InChIKey | TVZVESVDIKQBTL-SSDOTTSWSA-N |
| XLogP | 3.36 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.73 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|