C13H13ClN2O2S — CID 64993310
methyl 2-chloro-5-[1-(1,3-thiazol-2-yl)ethylamino]benzoate (PubChem CID 64993310) has the molecular formula C13H13ClN2O2S and a molecular weight of 296.78 g/mol. Its IUPAC name is methyl 2-chloro-5-[1-(1,3-thiazol-2-yl)ethylamino]benzoate.
| Compound Name | methyl 2-chloro-5-[1-(1,3-thiazol-2-yl)ethylamino]benzoate |
|---|---|
| PubChem CID | 64993310 |
| Molecular Formula | C13H13ClN2O2S |
| Molecular Weight | 296.78 g/mol |
| Exact Mass | 296.04 |
| IUPAC Name | methyl 2-chloro-5-[1-(1,3-thiazol-2-yl)ethylamino]benzoate |
| SMILES | COC(=O)c1cc(NC(C)c2nccs2)ccc1Cl |
| InChI | InChI=1S/C13H13ClN2O2S/c1-8(12-15-5-6-19-12)16-9-3-4-11(14)10(7-9)13(17)18-2/h3-8,16H,1-2H3 |
| InChIKey | COTQOZXTPFGMAI-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.78 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |