C12H10ClN3S — CID 63938853
2-chloro-4-[1-(1,3-thiazol-2-yl)ethylamino]benzonitrile (PubChem CID 63938853) has the molecular formula C12H10ClN3S and a molecular weight of 263.75 g/mol. Its IUPAC name is 2-chloro-4-[1-(1,3-thiazol-2-yl)ethylamino]benzonitrile.
| Compound Name | 2-chloro-4-[1-(1,3-thiazol-2-yl)ethylamino]benzonitrile |
|---|---|
| PubChem CID | 63938853 |
| Molecular Formula | C12H10ClN3S |
| Molecular Weight | 263.75 g/mol |
| Exact Mass | 263.03 |
| IUPAC Name | 2-chloro-4-[1-(1,3-thiazol-2-yl)ethylamino]benzonitrile |
| SMILES | CC(Nc1ccc(C#N)c(Cl)c1)c1nccs1 |
| InChI | InChI=1S/C12H10ClN3S/c1-8(12-15-4-5-17-12)16-10-3-2-9(7-14)11(13)6-10/h2-6,8,16H,1H3 |
| InChIKey | DGJBJDAXYBYXAH-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.75 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |