C14H12ClN3S — CID 63613248
7-chloro-N-[1-(1,3-thiazol-2-yl)ethyl]quinolin-4-amine (PubChem CID 63613248) has the molecular formula C14H12ClN3S and a molecular weight of 289.79 g/mol. Its IUPAC name is 7-chloro-N-[1-(1,3-thiazol-2-yl)ethyl]quinolin-4-amine.
| Compound Name | 7-chloro-N-[1-(1,3-thiazol-2-yl)ethyl]quinolin-4-amine |
|---|---|
| PubChem CID | 63613248 |
| Molecular Formula | C14H12ClN3S |
| Molecular Weight | 289.79 g/mol |
| Exact Mass | 289.04 |
| IUPAC Name | 7-chloro-N-[1-(1,3-thiazol-2-yl)ethyl]quinolin-4-amine |
| SMILES | CC(Nc1ccnc2cc(Cl)ccc12)c1nccs1 |
| InChI | InChI=1S/C14H12ClN3S/c1-9(14-17-6-7-19-14)18-12-4-5-16-13-8-10(15)2-3-11(12)13/h2-9H,1H3,(H,16,18) |
| InChIKey | DBUUVNLIMRJBKX-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.79 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |