C13H21FN2 — CID 63844106
3-N-(3-ethylpentan-2-yl)-5-fluorobenzene-1,3-diamine (PubChem CID 63844106) has the molecular formula C13H21FN2 and a molecular weight of 224.32 g/mol. Its IUPAC name is 3-N-(3-ethylpentan-2-yl)-5-fluorobenzene-1,3-diamine.
| Compound Name | 3-N-(3-ethylpentan-2-yl)-5-fluorobenzene-1,3-diamine |
|---|---|
| PubChem CID | 63844106 |
| Molecular Formula | C13H21FN2 |
| Molecular Weight | 224.32 g/mol |
| Exact Mass | 224.17 |
| IUPAC Name | 3-N-(3-ethylpentan-2-yl)-5-fluorobenzene-1,3-diamine |
| SMILES | CCC(CC)C(C)Nc1cc(N)cc(F)c1 |
| InChI | InChI=1S/C13H21FN2/c1-4-10(5-2)9(3)16-13-7-11(14)6-12(15)8-13/h6-10,16H,4-5,15H2,1-3H3 |
| InChIKey | APLSUWQRPYAOGK-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.32 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|