C11H17FN2O2 — CID 107864533
2-(3-amino-5-fluoroanilino)-2-ethylpropane-1,3-diol (PubChem CID 107864533) has the molecular formula C11H17FN2O2 and a molecular weight of 228.27 g/mol. Its IUPAC name is 2-(3-amino-5-fluoroanilino)-2-ethylpropane-1,3-diol.
| Compound Name | 2-(3-amino-5-fluoroanilino)-2-ethylpropane-1,3-diol |
|---|---|
| PubChem CID | 107864533 |
| Molecular Formula | C11H17FN2O2 |
| Molecular Weight | 228.27 g/mol |
| Exact Mass | 228.13 |
| IUPAC Name | 2-(3-amino-5-fluoroanilino)-2-ethylpropane-1,3-diol |
| SMILES | CCC(CO)(CO)Nc1cc(N)cc(F)c1 |
| InChI | InChI=1S/C11H17FN2O2/c1-2-11(6-15,7-16)14-10-4-8(12)3-9(13)5-10/h3-5,14-16H,2,6-7,13H2,1H3 |
| InChIKey | QKRNPISERGYABS-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.27 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|