C17H20ClFN2 — CID 107364435
2-benzyl-2-N-(3-chloro-5-fluorophenyl)butane-1,2-diamine (PubChem CID 107364435) has the molecular formula C17H20ClFN2 and a molecular weight of 306.81 g/mol. Its IUPAC name is 2-benzyl-2-N-(3-chloro-5-fluorophenyl)butane-1,2-diamine.
| Compound Name | 2-benzyl-2-N-(3-chloro-5-fluorophenyl)butane-1,2-diamine |
|---|---|
| PubChem CID | 107364435 |
| Molecular Formula | C17H20ClFN2 |
| Molecular Weight | 306.81 g/mol |
| Exact Mass | 306.13 |
| IUPAC Name | 2-benzyl-2-N-(3-chloro-5-fluorophenyl)butane-1,2-diamine |
| SMILES | CCC(CN)(Cc1ccccc1)Nc1cc(F)cc(Cl)c1 |
| InChI | InChI=1S/C17H20ClFN2/c1-2-17(12-20,11-13-6-4-3-5-7-13)21-16-9-14(18)8-15(19)10-16/h3-10,21H,2,11-12,20H2,1H3 |
| InChIKey | ANLIDCGFOYVEQZ-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.81 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |