C14H22ClFN2 — CID 107364651
2-N-(3-chloro-5-fluorophenyl)-2,5-dimethylhexane-1,2-diamine (PubChem CID 107364651) has the molecular formula C14H22ClFN2 and a molecular weight of 272.80 g/mol. Its IUPAC name is 2-N-(3-chloro-5-fluorophenyl)-2,5-dimethylhexane-1,2-diamine.
| Compound Name | 2-N-(3-chloro-5-fluorophenyl)-2,5-dimethylhexane-1,2-diamine |
|---|---|
| PubChem CID | 107364651 |
| Molecular Formula | C14H22ClFN2 |
| Molecular Weight | 272.80 g/mol |
| Exact Mass | 272.15 |
| IUPAC Name | 2-N-(3-chloro-5-fluorophenyl)-2,5-dimethylhexane-1,2-diamine |
| SMILES | CC(C)CCC(C)(CN)Nc1cc(F)cc(Cl)c1 |
| InChI | InChI=1S/C14H22ClFN2/c1-10(2)4-5-14(3,9-17)18-13-7-11(15)6-12(16)8-13/h6-8,10,18H,4-5,9,17H2,1-3H3 |
| InChIKey | DSNQUMGPYCNVHD-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.80 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |