C15H25ClN2 — CID 104721876
2-N-(3-chloro-4-methylphenyl)-2,5-dimethylhexane-1,2-diamine (PubChem CID 104721876) has the molecular formula C15H25ClN2 and a molecular weight of 268.83 g/mol. Its IUPAC name is 2-N-(3-chloro-4-methylphenyl)-2,5-dimethylhexane-1,2-diamine.
| Compound Name | 2-N-(3-chloro-4-methylphenyl)-2,5-dimethylhexane-1,2-diamine |
|---|---|
| PubChem CID | 104721876 |
| Molecular Formula | C15H25ClN2 |
| Molecular Weight | 268.83 g/mol |
| Exact Mass | 268.17 |
| IUPAC Name | 2-N-(3-chloro-4-methylphenyl)-2,5-dimethylhexane-1,2-diamine |
| SMILES | Cc1ccc(NC(C)(CN)CCC(C)C)cc1Cl |
| InChI | InChI=1S/C15H25ClN2/c1-11(2)7-8-15(4,10-17)18-13-6-5-12(3)14(16)9-13/h5-6,9,11,18H,7-8,10,17H2,1-4H3 |
| InChIKey | IXNJVYQCMIZGFL-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.83 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |