C11H17ClN2 — CID 94256638
N'-(3-chloro-4-methylphenyl)butane-1,4-diamine (PubChem CID 94256638) has the molecular formula C11H17ClN2 and a molecular weight of 212.72 g/mol. Its IUPAC name is N'-(3-chloro-4-methylphenyl)butane-1,4-diamine.
| Compound Name | N'-(3-chloro-4-methylphenyl)butane-1,4-diamine |
|---|---|
| PubChem CID | 94256638 |
| Molecular Formula | C11H17ClN2 |
| Molecular Weight | 212.72 g/mol |
| Exact Mass | 212.11 |
| IUPAC Name | N'-(3-chloro-4-methylphenyl)butane-1,4-diamine |
| SMILES | Cc1ccc(NCCCCN)cc1Cl |
| InChI | InChI=1S/C11H17ClN2/c1-9-4-5-10(8-11(9)12)14-7-3-2-6-13/h4-5,8,14H,2-3,6-7,13H2,1H3 |
| InChIKey | GSNYFJNUBYARET-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.72 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|