C12H17F2N — CID 62604630
N-[2-(3,5-difluorophenyl)ethyl]butan-2-amine (PubChem CID 62604630) has the molecular formula C12H17F2N and a molecular weight of 213.27 g/mol. Its IUPAC name is N-[2-(3,5-difluorophenyl)ethyl]butan-2-amine.
| Compound Name | N-[2-(3,5-difluorophenyl)ethyl]butan-2-amine |
|---|---|
| PubChem CID | 62604630 |
| Molecular Formula | C12H17F2N |
| Molecular Weight | 213.27 g/mol |
| Exact Mass | 213.13 |
| IUPAC Name | N-[2-(3,5-difluorophenyl)ethyl]butan-2-amine |
| SMILES | CCC(C)NCCc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C12H17F2N/c1-3-9(2)15-5-4-10-6-11(13)8-12(14)7-10/h6-9,15H,3-5H2,1-2H3 |
| InChIKey | XXTZHXRKMZAXFC-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.27 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |