C12H18FN — CID 43565886
N-[2-(3-fluorophenyl)ethyl]butan-2-amine (PubChem CID 43565886) has the molecular formula C12H18FN and a molecular weight of 195.28 g/mol. Its IUPAC name is N-[2-(3-fluorophenyl)ethyl]butan-2-amine.
| Compound Name | N-[2-(3-fluorophenyl)ethyl]butan-2-amine |
|---|---|
| PubChem CID | 43565886 |
| Molecular Formula | C12H18FN |
| Molecular Weight | 195.28 g/mol |
| Exact Mass | 195.14 |
| IUPAC Name | N-[2-(3-fluorophenyl)ethyl]butan-2-amine |
| SMILES | CCC(C)NCCc1cccc(F)c1 |
| InChI | InChI=1S/C12H18FN/c1-3-10(2)14-8-7-11-5-4-6-12(13)9-11/h4-6,9-10,14H,3,7-8H2,1-2H3 |
| InChIKey | VLQXVXHUKKIUAT-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.28 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |