C16H16F3N — CID 43565905
1-(3,4-difluorophenyl)-N-[2-(3-fluorophenyl)ethyl]ethanamine (PubChem CID 43565905) has the molecular formula C16H16F3N and a molecular weight of 279.31 g/mol. Its IUPAC name is 1-(3,4-difluorophenyl)-N-[2-(3-fluorophenyl)ethyl]ethanamine.
| Compound Name | 1-(3,4-difluorophenyl)-N-[2-(3-fluorophenyl)ethyl]ethanamine |
|---|---|
| PubChem CID | 43565905 |
| Molecular Formula | C16H16F3N |
| Molecular Weight | 279.31 g/mol |
| Exact Mass | 279.12 |
| IUPAC Name | 1-(3,4-difluorophenyl)-N-[2-(3-fluorophenyl)ethyl]ethanamine |
| SMILES | CC(NCCc1cccc(F)c1)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C16H16F3N/c1-11(13-5-6-15(18)16(19)10-13)20-8-7-12-3-2-4-14(17)9-12/h2-6,9-11,20H,7-8H2,1H3 |
| InChIKey | IUYQYDMRQHQGBA-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.31 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |