C16H17F2N — CID 43178590
1-(3,4-difluorophenyl)-N-(2-phenylethyl)ethanamine (PubChem CID 43178590) has the molecular formula C16H17F2N and a molecular weight of 261.31 g/mol. Its IUPAC name is 1-(3,4-difluorophenyl)-N-(2-phenylethyl)ethanamine.
| Compound Name | 1-(3,4-difluorophenyl)-N-(2-phenylethyl)ethanamine |
|---|---|
| PubChem CID | 43178590 |
| Molecular Formula | C16H17F2N |
| Molecular Weight | 261.31 g/mol |
| Exact Mass | 261.13 |
| IUPAC Name | 1-(3,4-difluorophenyl)-N-(2-phenylethyl)ethanamine |
| SMILES | CC(NCCc1ccccc1)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C16H17F2N/c1-12(14-7-8-15(17)16(18)11-14)19-10-9-13-5-3-2-4-6-13/h2-8,11-12,19H,9-10H2,1H3 |
| InChIKey | OVHAPHNKAWNJMY-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.31 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |