C18H21F2NO2 — CID 110877396
1-[1-(3,4-difluorophenyl)ethylamino]-3-phenylmethoxypropan-2-ol (PubChem CID 110877396) has the molecular formula C18H21F2NO2 and a molecular weight of 321.37 g/mol. Its IUPAC name is 1-[1-(3,4-difluorophenyl)ethylamino]-3-phenylmethoxypropan-2-ol.
| Compound Name | 1-[1-(3,4-difluorophenyl)ethylamino]-3-phenylmethoxypropan-2-ol |
|---|---|
| PubChem CID | 110877396 |
| Molecular Formula | C18H21F2NO2 |
| Molecular Weight | 321.37 g/mol |
| Exact Mass | 321.15 |
| IUPAC Name | 1-[1-(3,4-difluorophenyl)ethylamino]-3-phenylmethoxypropan-2-ol |
| SMILES | CC(NCC(O)COCc1ccccc1)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C18H21F2NO2/c1-13(15-7-8-17(19)18(20)9-15)21-10-16(22)12-23-11-14-5-3-2-4-6-14/h2-9,13,16,21-22H,10-12H2,1H3 |
| InChIKey | CRVXKSOTNVWREO-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.37 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |