C15H24FNO2 — CID 81348160
1-[[(1S)-1-(4-fluorophenyl)ethyl]amino]-3-(2-methylpropoxy)propan-2-ol (PubChem CID 81348160) has the molecular formula C15H24FNO2 and a molecular weight of 269.36 g/mol. Its IUPAC name is 1-[[(1S)-1-(4-fluorophenyl)ethyl]amino]-3-(2-methylpropoxy)propan-2-ol.
| Compound Name | 1-[[(1S)-1-(4-fluorophenyl)ethyl]amino]-3-(2-methylpropoxy)propan-2-ol |
|---|---|
| PubChem CID | 81348160 |
| Molecular Formula | C15H24FNO2 |
| Molecular Weight | 269.36 g/mol |
| Exact Mass | 269.18 |
| IUPAC Name | 1-[[(1S)-1-(4-fluorophenyl)ethyl]amino]-3-(2-methylpropoxy)propan-2-ol |
| SMILES | CC(C)COCC(O)CN[C@@H](C)c1ccc(F)cc1 |
| InChI | InChI=1S/C15H24FNO2/c1-11(2)9-19-10-15(18)8-17-12(3)13-4-6-14(16)7-5-13/h4-7,11-12,15,17-18H,8-10H2,1-3H3/t12-,15?/m0/s1 |
| InChIKey | GFQVIDRBJFLRPP-SFVWDYPZSA-N |
| XLogP | 2.51 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.36 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |