C13H23NO2S — CID 81408465
1-(2-methylpropoxy)-3-[[(1S)-1-thiophen-2-ylethyl]amino]propan-2-ol (PubChem CID 81408465) has the molecular formula C13H23NO2S and a molecular weight of 257.40 g/mol. Its IUPAC name is 1-(2-methylpropoxy)-3-[[(1S)-1-thiophen-2-ylethyl]amino]propan-2-ol.
| Compound Name | 1-(2-methylpropoxy)-3-[[(1S)-1-thiophen-2-ylethyl]amino]propan-2-ol |
|---|---|
| PubChem CID | 81408465 |
| Molecular Formula | C13H23NO2S |
| Molecular Weight | 257.40 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | 1-(2-methylpropoxy)-3-[[(1S)-1-thiophen-2-ylethyl]amino]propan-2-ol |
| SMILES | CC(C)COCC(O)CN[C@@H](C)c1cccs1 |
| InChI | InChI=1S/C13H23NO2S/c1-10(2)8-16-9-12(15)7-14-11(3)13-5-4-6-17-13/h4-6,10-12,14-15H,7-9H2,1-3H3/t11-,12?/m0/s1 |
| InChIKey | JJEZMMFULMQILZ-PXYINDEMSA-N |
| XLogP | 2.43 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.40 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |