C17H24ClNO2S — CID 138959135
1-[(4-methylphenyl)methoxy]-3-(1-thiophen-2-ylethylamino)propan-2-ol;hydrochloride (PubChem CID 138959135) has the molecular formula C17H24ClNO2S and a molecular weight of 341.90 g/mol. Its IUPAC name is 1-[(4-methylphenyl)methoxy]-3-(1-thiophen-2-ylethylamino)propan-2-ol;hydrochloride.
| Compound Name | 1-[(4-methylphenyl)methoxy]-3-(1-thiophen-2-ylethylamino)propan-2-ol;hydrochloride |
|---|---|
| PubChem CID | 138959135 |
| Molecular Formula | C17H24ClNO2S |
| Molecular Weight | 341.90 g/mol |
| Exact Mass | 341.12 |
| IUPAC Name | 1-[(4-methylphenyl)methoxy]-3-(1-thiophen-2-ylethylamino)propan-2-ol;hydrochloride |
| SMILES | Cc1ccc(COCC(O)CNC(C)c2cccs2)cc1.Cl |
| InChI | InChI=1S/C17H23NO2S.ClH/c1-13-5-7-15(8-6-13)11-20-12-16(19)10-18-14(2)17-4-3-9-21-17;/h3-9,14,16,18-19H,10-12H2,1-2H3;1H |
| InChIKey | HGEFYYDSXYHJIM-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.90 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |